What is the solubility of 2/3 dimethylphenol?
What is the solubility of 2/3 dimethylphenol?
4.57 mg/mL
2,3-Dimethylphenol, also known as 1,2,3-xylenol or 3-hydroxy-O-xylene, belongs to the class of organic compounds known as ortho cresols….3D Structure for HMDB0032148 (2,3-Dimethylphenol)
| Property | Value | Reference |
|---|---|---|
| Water Solubility | 4.57 mg/mL at 25 °C | Not Available |
| LogP | 2.48 | Not Available |
Is 2 3 dimethylphenol soluble in water?
2,3-dimethylphenol is a member of the class of compounds known as ortho cresols. 2,3-dimethylphenol is slightly soluble (in water) and a very weakly acidic compound (based on its pKa).
What is the density of 2 6 dimethylphenol?
1.1500g/mL
Specifications
| Specific Gravity | 1.15 |
|---|---|
| Flash Point | 73°C |
| Melting Point | 45.0°C to 48.0°C |
| Density | 1.1500g/mL |
| Quantity | 1kg |
What is the molecular weight of 2 6 dimethylphenol?
122.16
2,6-Dimethylphenol
| PubChem CID | 11335 |
|---|---|
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C8H10O |
| Synonyms | 2,6-DIMETHYLPHENOL 576-26-1 2,6-Xylenol Phenol, 2,6-dimethyl- 2,6-Dimethyl phenol More… |
| Molecular Weight | 122.16 |
What is the structure of 2/3 Diethylphenol?
Identification of 2,3-diethylphenol Chemical Compound
| Chemical Formula | C10H14O |
|---|---|
| IUPAC Name | 2,3-diethylphenol |
| SMILES String | CCc1cccc(O)c1CC |
| InChI | InChI=1S/C10H14O/c1-3-8-6-5-7-10(11)9(8)4-2/h5-7,11H,3-4H2,1-2H3 |
| InChIKey | RLEWTHFVGOXXTN-UHFFFAOYSA-N |
Is 2 6 dimethylphenol an acid or base?
2,6-Xylenol is a chemical compound which is one of the six isomers of xylenol. It is also commonly known as 2,6-dimethylphenol (DMP)….2,6-Xylenol.
| Names | |
|---|---|
| Boiling point | 203 °C (397 °F; 476 K) |
| Hazards | |
| Flash point | 86 °C (187 °F; 359 K) |
What is the structure of 3 Cyclohexylpentan 3 OL?
3-cyclohexylpentan-3-ol
| Compound number: | MolPort-011-893-521 |
|---|---|
| IUPAC traditional: | 3-cyclohexylpentan-3-ol |
| SMILES: | CCC(O)(CC)C1CCCCC1 |
| InChI key: | CJXIUXXPIYXGCT-UHFFFAOYSA-N |
| Molecular formula: | C11H22O |
What is the structure of 1 Phenylpropan 2 OL?
1-Phenyl-2-propanol
| PubChem CID | 94185 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C9H12O |
| Synonyms | 1-Phenyl-2-propanol 1-Phenylpropan-2-ol 698-87-3 Benzyl methyl carbinol 14898-87-4 More… |
| Molecular Weight | 136.19 |
Is benzoic acid harmful?
Benzoic acid is non-toxic and stable under ordinary conditions. While occupational exposure limits have not been established, benzoic acid may still pose a health risk and, therefore, the safe work practices should always be followed: Wash hands thoroughly after handling. Use only in a well-ventilated area.
What is the structure of 2 5 dimethylphenol?
2,5-Dimethylphenol
| PubChem CID | 7267 |
|---|---|
| Molecular Formula | C8H10O |
| Synonyms | 2,5-DIMETHYLPHENOL 95-87-4 2,5-Xylenol p-Xylenol Phenol, 2,5-dimethyl- More… |
| Molecular Weight | 122.16 |
| Dates | Modify 2021-10-09 Create 2005-03-26 |
What kind of solid is 2, 3 dimethylphenol?
2,3-dimethylphenol appears as colorless crystalline solid or brown chunky solid. Taste threshold concentration 0.03 mg/L. Odor threshold concentration 0.5 mg/L. (NTP, 1992) 2, 3-Dimethylphenol is a constituent of Valerianella locusta (corn salad).
What is the Henry’s constant for 2, 3 dimethylphenol?
The Henry’s Law constant for 2,3-dimethylphenol is estimated as 3.1X10-6 atm-cu m/mole (SRC) from its experimental values for vapor pressure, 0.089 mm Hg (1), and water solubility, 4570 mg/l (2). This Henry’s Law constant indicates that 2,3-dimethylphenol is expected to volatilize from water surfaces (3).
What are the density values of all metals?
The table below lists out the density values of common metals and alloys, including iron, carbon steel, steel wire, alloy steel, bearing steel, stainless steel, copper, brass, bronze, aluminum, magnesium, nickel, zinc, lead etc. Hope it is of help to you. Sharing is caring!
What foods contain 2, 3-dimethylphenol isomer?
Dimethylphenols, of which 2,3-dimethylphenol is an isomer, are present in the essential oils of various conifers, in tea, in tobacco and tobacco smoke, in roasted coffee and in various smoked foods(1).