How many stereoisomers are formed from the reaction of trans-cinnamic acid with Br2?
How many stereoisomers are formed from the reaction of trans-cinnamic acid with Br2?
four possible stereoisomers
The product of this reaction contains two asymmetric centers, therefore there are four possible stereoisomers that could possibly be formed in the reaction.
What is the Iupac name of cinnamic acid?
| IUPAC Name | (E)-3-phenylprop-2-enoic acid |
|---|---|
| Alternative Names | CINNAMIC ACID TRANS-CINNAMIC ACID (E)-Cinnamic acid 3-Phenylacrylic acid trans-3-Phenylacrylic acid |
| Molecular Formula | C9H8O2 |
| Molar Mass | 148.161 g/mol |
| InChI | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+ |
What was the recrystallizing solvent used in the experiment on bromination of trans-cinnamic acid?
Recrystallize to purify the crude product using a mixed solvent system of water and ethanol.
What is the structure of cinnamic acid?
C9H8O2
Cinnamic acid/Formula
Why must you add more bromine in the production of 2/3 dibromo 3 Phenylpropanoic acid?
In order to form product Bromine MUST be present so if all the bromine is used and solution turns clear more bromine must be added to keep the reaction shifted to the right in order to favor the production of 2,3-dibromo-3-phenylpropanoic acid.
Why use of liquid bromine is avoided while carrying out bromination in lab?
The present method of bromination avoids the use of hazardous liquid bromine. Instead, the required bromine is generated in situ and used up quickly. There will be very little pollution by bromine in the laboratory. The use of organic acids instead of mineral acids makes it safer and free from corrosive fumes.
Are you pack name of cinnamic acid?
The cinnamic acid IUPAC name is (2E)-3-Phenylprop-2-enoic acid.
How many types of H are there in cinnamic acid?
The cinnamic acids [(2E)-3-phenylprop-2-enoic acid] and its four homologous derivatives such as p-hydroxy, p-hydroxymethoxy, p-hydroxydimethoxy, and dihydroxy are well known for their antioxidant, antitumor, antimicrobial, and antimycobacterial properties.
Why must you add more bromine in the production of 2/3 dibromo 3-phenylpropanoic acid?
Is cinnamic acid a monocarboxylic acid?
Cinnamic acid is a monocarboxylic acid that consists of acrylic acid bearing a phenyl substituent at the 3-position. It is found in Cinnamomum cassia. It is a member of styrenes and a member of cinnamic acids.
What are the dangers of using bromine reagent?
Causes severe eye irritation and possible burns. Skin: Causes skin irritation and possible burns. Ingestion: Causes severe digestive tract burns with abdominal pain, vomiting, and possible death. Inhalation: Irritation may lead to chemical pneumonitis and pulmonary edema.